| Catalog Number | ACM18001133-3 |
|---|---|
| CAS Number | 18001-13-3 |
| Structure | ![]() |
| Synonyms | Silane,(4-ethenylphenyl)trimethoxy- |
| IUPAC Name | (4-ethenylphenyl)-trimethoxysilane |
| Molecular Weight | 224.33 |
| Molecular Formula | C11H16O3Si |
| Canonical SMILES | CO[Si](C1=CC=C(C=C1)C=C)(OC)OC |
| InChI | InChI=1S/C11H16O3Si/c1-5-10-6-8-11(9-7-10)15(12-2,13-3)14-4/h5-9H,1H2,2-4H3 |
| InChI Key | LTQBNYCMVZQRSD-UHFFFAOYSA-N |
| Boiling Point | 77 °C/0.2 mmHg |
| Purity | >97.0%(GC) |
| Appearance | Colorless to light yellow clear liquid |
| Storage | Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity | 188 |
| Exact Mass | 224.086871g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 15 |
| HS Code | 2931900090 |
| MDL Number | MFCD21596662 |
| Monoisotopic Mass | 224.086871g/mol |
| Rotatable Bond Count | 5 |
※ Please kindly noted that this product is for research use only.