| Catalog Number |
ACM18001133-3 |
| CAS Number |
18001-13-3 |
| Structure |
 |
| Synonyms |
Silane,(4-ethenylphenyl)trimethoxy- |
| IUPAC Name |
(4-ethenylphenyl)-trimethoxysilane |
| Molecular Weight |
224.33 |
| Molecular Formula |
C11H16O3Si |
| Canonical SMILES |
CO[Si](C1=CC=C(C=C1)C=C)(OC)OC |
| InChI |
InChI=1S/C11H16O3Si/c1-5-10-6-8-11(9-7-10)15(12-2,13-3)14-4/h5-9H,1H2,2-4H3 |
| InChI Key |
LTQBNYCMVZQRSD-UHFFFAOYSA-N |
| Boiling Point |
77 °C/0.2 mmHg |
| Purity |
>97.0%(GC) |
| Appearance |
Colorless to light yellow clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
188 |
| Exact Mass |
224.086871g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
15 |
| HS Code |
2931900090 |
| MDL Number |
MFCD21596662 |
| Monoisotopic Mass |
224.086871g/mol |
| Rotatable Bond Count |
5 |
