Tris(Tert-Pentoxy)Silanol
| Catalog Number | ACM17906353 |
|---|---|
| Product Name | Tris(Tert-Pentoxy)Silanol |
| CAS | 17906-35-3 |
| Structure |  |
| Description | Atomic number of base material: 14 Silicon |
| Synonyms | Tris(2-methyl-2-butanyl) hydrogen orthosilicate |
| IUPAC Name | Hydroxy-tris(2-methylbutan-2-yloxy)silane |
| Molecular Weight | 306.51 |
| Molecular Formula | C15H34O4Si |
| Canonical SMILES | CCC(C)(C)O[Si](O)(OC(C)(C)CC)OC(C)(C)CC |
| InChI | InChI=1S/C15H34O4Si/c1-10-13(4,5)17-20(16,18-14(6,7)11-2)19-15(8,9)12-3/h16H,10-12H2,1-9H3 |
| InChI Key | ORJFXWYTRPGGRK-UHFFFAOYSA-N |
| Boiling Point | 96-99 °C/2-3mmHg (lit.) |
| Flash Point | 223 °F |
| Purity | 95%+ |
| Density | 0.944 g/mL at 25 °C (lit.) |
| Appearance | Colorless liquid |
| Application | Precursors Packaged for Depositions Systems |
| Storage | room temp |
| Complexity | 255 |
| Exact Mass | 306.2226361 |
| Formal Charge | 0 |
| Heavy Atom Count | 20 |
| Monoisotopic Mass | 306.2226361 |
| Rotatable Bond Count | 9 |
| Topological Polar Surface Area | 47.9 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
