| Catalog Number |
ACM4325853-1 |
| CAS Number |
4325-85-3 |
| Structure |
 |
| Synonyms |
Boric acid tris(trimethylsilyl) ester
Tris(trimethylsiloxy)boron |
| IUPAC Name |
tris(trimethylsilyl) borate |
| Molecular Weight |
278.38 g/mol |
| Molecular Formula |
[(CH3)3SiO]3B |
| Canonical SMILES |
B(O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI |
InChI=1S/C9H27BO3Si3/c1-14(2,3)11-10(12-15(4,5)6)13-16(7,8)9/h1-9H3 |
| InChI Key |
YZYKZHPNRDIPFA-UHFFFAOYSA-N |
| Purity |
0.98 |
| Application |
Tris(Trimethylsilyl) Borate serves as a multifunctional additive improving the performance of lithium-ion batteries and acting as an intermediate in organic synthesis By enhancing the cycle performance of high-voltage cathode materials like LiMn2O4 and LiNi05Co02Mn03O2 it provides a protective cathode function It also optimizes the cycle life of Li-ion batteries with LiMn2O4 and LiFePO4 cathodes at elevated temperatures such as 55 °C Tris(Trimethylsilyl) Borate is shown to form a thin dense cathode-electrolyte interphase (CEI) film rich in Si–O and B–O bonds effectively reducing interfacial resistance growth and facilitating lithium-ion transfer These properties make it highly effective compared to alternatives like Tris(Trimethylsilyl) Phosphate by easily interacting with lithium ions and modifying the solvation structure to enhance cycling performance |
| Storage |
Moisture Sensitive. Ambient temperatures. |
| Complexity |
180 |
| Exact Mass |
278.136104g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
16 |
| Monoisotopic Mass |
278.136104g/mol |
| Rotatable Bond Count |
6 |
