1,3-Bis(3,3,3-Trifluoropropyl)-1,1,3,3-Tetramethyldisilazane
| Catalog Number | ACM39482876-2 |
|---|---|
| Product Name | 1,3-Bis(3,3,3-Trifluoropropyl)-1,1,3,3-Tetramethyldisilazane |
| CAS | 39482-87-6 |
| Structure |  |
| IUPAC Name | 3-[[[dimethyl(3,3,3-trifluoropropyl)silyl]amino]-dimethylsilyl]-1,1,1-trifluoropropane |
| Molecular Weight | 325.45 g/mol |
| Molecular Formula | C10H21F6NSi2 |
| Canonical SMILES | C[Si](C)(CCC(F)(F)F)N[Si](C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C10H21F6NSi2/c1-18(2,7-5-9(11,12)13)17-19(3,4)8-6-10(14,15)16/h17H,5-8H2,1-4H3 |
| InChI Key | ITRFWRDOAWGZFV-UHFFFAOYSA-N |
| Boiling Point | 119 °C(20 mmHg) |
| Flash Point | 78 °C |
| Purity | >94% |
| Solubility | Decomposes in contact with water,Insoluble in water. |
| Appearance | Colorless to light yellow clear liquid |
| Storage | Store under inert gas. |
| Complexity | 257 |
| Exact Mass | 325.111672g/mol |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Monoisotopic Mass | 325.111672g/mol |
| Rotatable Bond Count | 6 |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
