| Catalog Number |
ACM39482876-2 |
| CAS Number |
39482-87-6 |
| Structure |
 |
| IUPAC Name |
3-[[[dimethyl(3,3,3-trifluoropropyl)silyl]amino]-dimethylsilyl]-1,1,1-trifluoropropane |
| Molecular Weight |
325.45 g/mol |
| Molecular Formula |
C10H21F6NSi2 |
| Canonical SMILES |
C[Si](C)(CCC(F)(F)F)N[Si](C)(C)CCC(F)(F)F |
| InChI |
InChI=1S/C10H21F6NSi2/c1-18(2,7-5-9(11,12)13)17-19(3,4)8-6-10(14,15)16/h17H,5-8H2,1-4H3 |
| InChI Key |
ITRFWRDOAWGZFV-UHFFFAOYSA-N |
| Boiling Point |
119 °C(20 mmHg) |
| Flash Point |
78 °C |
| Purity |
>94% |
| Solubility |
Decomposes in contact with water,Insoluble in water. |
| Appearance |
Colorless to light yellow clear liquid |
| Storage |
Store under inert gas. |
| Complexity |
257 |
| EC Number |
254-470-9 |
| Exact Mass |
325.111672g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
19 |
| MDL Number |
MFCD00153070 |
| Monoisotopic Mass |
325.111672g/mol |
| Reaxys Registry Number |
19243318 |
| Rotatable Bond Count |
6 |
| Specific Gravity |
1.1 |
