3-(Trichlorosilyl)propyl 2-Bromo-2-methylpropanoate
| Catalog Number | ACM688359844-1 |
|---|---|
| Product Name | 3-(Trichlorosilyl)propyl 2-Bromo-2-methylpropanoate |
| CAS | 688359-84-4 |
| Synonyms | 2-Bromo-2-methylpropionic acid 3-(trichlorosilyl)propyl ester |
| IUPAC Name | 3-trichlorosilylpropyl 2-bromo-2-methylpropanoate |
| Molecular Weight | 342.51 |
| Molecular Formula | C7H12BrCl3O2Si |
| Canonical SMILES | CC(C)(C(=O)OCCC[Si](Cl)(Cl)Cl)Br |
| InChI | InChI=1S/C7H12BrCl3O2Si/c1-7(2,8)6(12)13-4-3-5-14(9,10)11/h3-5H2,1-2H3 |
| InChI Key | GEVOCWHKMYIZGM-UHFFFAOYSA-N |
| Flash Point | 136 °C |
| Purity | >95% (GC) |
| Density | 1.484±0.06 g/cm³ (Predicted) |
| Appearance | Colorless to light orange to yellow clear liquid |
| Storage | Store under inert gas |
| Complexity | 206 |
| Exact Mass | 339.88555 |
| Formal Charge | 0 |
| Heavy Atom Count | 14 |
| Hydrogen Bond Acceptor Count | 2 |
| Hydrogen Bond Donor Count | 0 |
| Monoisotopic Mass | 339.88555 |
| Rotatable Bond Count | 5 |
| Topological Polar Surface Area | 26.3 Ų |
| MSDS | Download MSDS |
| COA | Download COA |
| SpecSheet | Download Spec Sheet |
※ Please kindly noted that this product is for research use only.
