| Catalog Number |
ACM83048651-1 |
| CAS Number |
83048-65-1 |
| IUPAC Name |
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(trimethoxy)silane |
| Molecular Weight |
568.3 g/mol |
| Molecular Formula |
C13H13F17O3Si |
| Canonical SMILES |
CO[Si](CCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(OC)OC |
| InChI |
InChI=1S/C13H13F17O3Si/c1-31-34(32-2,33-3)5-4-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h4-5H2,1-3H3 |
| InChI Key |
HJIMAFKWSKZMBK-UHFFFAOYSA-N |
| Purity |
≥97% |
| Application |
Trimethoxy(1H,1H,2H,2H-Heptadecafluorodecyl)Silane is a silicon-based monomer known for its versatile applications in enhancing surface properties of materials. It serves as an effective anti-fingerprint agent and protective coating for glass products like advanced mobile phone screens and camera lenses. The compound's fluorinated alkylsilane structure imparts a low refractive index, anti-sticking properties, and reactivity suitable for use on glass and ceramic surfaces. Beyond electronic products, it is instrumental in self-cleaning applications due to its hydrophobic and oleophobic treatment capabilities. Additionally, Trimethoxy(1H,1H,2H,2H-Heptadecafluorodecyl)Silane is used in preparing abrasion-resistant, super-antiwetting nylon surfaces, and as an additive, it enhances the hydrophobicity of carbon nanotube structures, contributing to the development of soil-repellent and wear-resistant coatings. |
| Complexity |
693 |
| Exact Mass |
568.03625g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
34 |
| MDL Number |
MFCD07368748 |
| Monoisotopic Mass |
568.03625g/mol |
| Rotatable Bond Count |
12 |
