| Catalog Number |
ACM49539880-6 |
| CAS Number |
49539-88-0 |
| IUPAC Name |
trimethoxy(2-phenylethyl)silane |
| Molecular Weight |
226.35 |
| Molecular Formula |
C11H18O3Si |
| Canonical SMILES |
CO[Si](CCC1=CC=CC=C1)(OC)OC |
| InChI |
InChI=1S/C11H18O3Si/c1-12-15(13-2,14-3)10-9-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChI Key |
UBMUZYGBAGFCDF-UHFFFAOYSA-N |
| Boiling Point |
122 °C/6 mmHg |
| Flash Point |
109 °C |
| Purity |
>95.0%(GC) |
| Appearance |
Colorless to light yellow to red clear liquid |
| Storage |
Room Temperature (Recommended in a cool and dark place, <15 °C) |
| Complexity |
157 |
| Exact Mass |
226.102521g/mol |
| Formal Charge |
0 |
| Heavy Atom Count |
15 |
| HS Code |
2931900090 |
| MDL Number |
MFCD00053852 |
| Monoisotopic Mass |
226.102521g/mol |
| Reaxys Registry Number |
3031224 |
| Rotatable Bond Count |
6 |
| Specific Gravity |
1.04 |
